C56H68BBr — CID 88915068
CID 88915068 (PubChem CID 88915068) has the molecular formula C56H68BBr and a molecular weight of 831.88 g/mol.
| Compound Name | CID 88915068 |
|---|---|
| PubChem CID | 88915068 |
| Molecular Formula | C56H68BBr |
| Molecular Weight | 831.88 g/mol |
| Exact Mass | 830.46 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(CCCCCCCC)(CCCCCCCC)c1cc3c(cc1-2)C(c1ccc(C(C)(C)C)cc1)(c1ccc(C(C)(C)C)cc1)c1cc(Br)ccc1-3 |
| InChI | InChI=1S/C56H68BBr/c1-9-11-13-15-17-19-33-55(34-20-18-16-14-12-10-2)49-35-43(57)29-31-45(49)47-38-52-48(37-50(47)55)46-32-30-44(58)36-51(46)56(52,41-25-21-39(22-26-41)53(3,4)5)42-27-23-40(24-28-42)54(6,7)8/h21-32,35-38H,9-20,33-34H2,1-8H3 |
| InChIKey | BNOVPLDAYONSPK-UHFFFAOYSA-N |
| XLogP | 15.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.88 |
| LogP ≤ 5 | 15.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|