C57H70BBr — CID 123344252
CID 123344252 (PubChem CID 123344252) has the molecular formula C57H70BBr and a molecular weight of 845.90 g/mol.
| Compound Name | CID 123344252 |
|---|---|
| PubChem CID | 123344252 |
| Molecular Formula | C57H70BBr |
| Molecular Weight | 845.90 g/mol |
| Exact Mass | 844.48 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(c1)C(CCCCCCCC)C(CCCCCCCC)c1cc3c(cc1-2)C(c1ccc(C(C)(C)C)cc1)(c1ccc(C(C)(C)C)cc1)c1cc(Br)ccc1-3 |
| InChI | InChI=1S/C57H70BBr/c1-9-11-13-15-17-19-21-45-46(22-20-18-16-14-12-10-2)50-37-52-48-34-32-44(59)36-53(48)57(41-27-23-39(24-28-41)55(3,4)5,42-29-25-40(26-30-42)56(6,7)8)54(52)38-51(50)47-33-31-43(58)35-49(45)47/h23-38,45-46H,9-22H2,1-8H3 |
| InChIKey | JBTFFVVWQMMOEX-UHFFFAOYSA-N |
| XLogP | 16.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.90 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|