C75H74Br2N2 — CID 140553749
9-N,10-N,10-N-tris(4-tert-butylphenyl)-9-N-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]anthracene-9,10-diamine (PubChem CID 140553749) has the molecular formula C75H74Br2N2 and a molecular weight of 1163.24 g/mol. Its IUPAC name is 9-N,10-N,10-N-tris(4-tert-butylphenyl)-9-N-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]anthracene-9,10-diamine.
| Compound Name | 9-N,10-N,10-N-tris(4-tert-butylphenyl)-9-N-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]anthracene-9,10-diamine |
|---|---|
| PubChem CID | 140553749 |
| Molecular Formula | C75H74Br2N2 |
| Molecular Weight | 1163.24 g/mol |
| Exact Mass | 1160.42 |
| IUPAC Name | 9-N,10-N,10-N-tris(4-tert-butylphenyl)-9-N-[4-[2,7-dibromo-9-(4-hexylphenyl)fluoren-9-yl]phenyl]anthracene-9,10-diamine |
| SMILES | CCCCCCc1ccc(C2(c3ccc(N(c4ccc(C(C)(C)C)cc4)c4c5ccccc5c(N(c5ccc(C(C)(C)C)cc5)c5ccc(C(C)(C)C)cc5)c5ccccc45)cc3)c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C75H74Br2N2/c1-11-12-13-14-19-50-24-26-54(27-25-50)75(68-48-56(76)36-46-62(68)63-47-37-57(77)49-69(63)75)55-34-44-61(45-35-55)79(60-42-32-53(33-43-60)74(8,9)10)71-66-22-17-15-20-64(66)70(65-21-16-18-23-67(65)71)78(58-38-28-51(29-39-58)72(2,3)4)59-40-30-52(31-41-59)73(5,6)7/h15-18,20-49H,11-14,19H2,1-10H3 |
| InChIKey | CPTABCNOYNUZPJ-UHFFFAOYSA-N |
| XLogP | 22.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.24 |
| LogP ≤ 5 | 22.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|