About CID 89302466
CID 89302466 (PubChem CID 89302466) has the molecular formula C79H70Br2
and a molecular weight of 1179.24 g/mol.
Molecular Properties
| Compound Name | CID 89302466 |
| PubChem CID | 89302466 |
| Molecular Formula | C79H70Br2 |
| Molecular Weight | 1179.24 g/mol |
| Exact Mass | 1176.38 |
| IUPAC Name | — |
| SMILES | CC1=CC2c3cc(C)c(C)cc3C3(c4cc(Br)ccc4-c4cc5c(cc43)-c3cc4c(cc3C5(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)-c3ccc(Br)cc3C43c4cc(C)c(C)cc4-c4cc(C)c(C)cc43)C2C=C1C |
| InChI | InChI=1S/C79H70Br2/c1-41-27-57-58-28-42(2)46(6)32-66(58)78(65(57)31-45(41)5)69-35-53(80)23-25-55(69)61-37-71-63(39-73(61)78)64-40-74-62(38-72(64)77(71,51-19-15-49(16-20-51)75(9,10)11)52-21-17-50(18-22-52)76(12,13)14)56-26-24-54(81)36-70(56)79(74)67-33-47(7)43(3)29-59(67)60-30-44(4)48(8)34-68(60)79/h15-40,57,65H,1-14H3 |
| InChIKey | PYXHBQGMVOWFSQ-UHFFFAOYSA-N |
| XLogP | 21.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 81 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 1179.24 |
| LogP ≤ 5 | 21.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 89302466 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 89302466?
The IUPAC name of CID 89302466 (CID 89302466) is not available.
What is the SMILES notation for CID 89302466?
The canonical SMILES for CID 89302466 is CC1=CC2c3cc(C)c(C)cc3C3(c4cc(Br)ccc4-c4cc5c(cc43)-c3cc4c(cc3C5(c3ccc(C(C)(C)C)cc3)c3ccc(C(C)(C)C)cc3)-c3ccc(Br)cc3C43c4cc(C)c(C)cc4-c4cc(C)c(C)cc43)C2C=C1C.
What is the InChIKey of CID 89302466?
The InChIKey is PYXHBQGMVOWFSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C79H70Br2/c1-41-27-57-58-28-42(2)46(6)32-66(58)78(65(57)31-45(41)5)69-35-53(80)23-25-55(69)61-37-71-63(39-73(61)78)64-40-74-62(38-72(64)77(71,51-19-15-49(16-20-51)75(9,10)11)52-21-17-50(18-22-52)76(12,13)14)56-26-24-54(81)36-70(56)79(74)67-33-47(7)43(3)29-59(67)60-30-44(4)48(8)34-68(60)79/h15-40,57,65H,1-14H3.
What are the key properties of CID 89302466?
CID 89302466 has a molecular weight of 1179.24 g/mol, XLogP of 21.30, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 89302466 is sourced from PubChem (CID 89302466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).