C27H20Br2 — CID 58371139
2,7-dibromo-9,9-bis(3-methylphenyl)fluorene (PubChem CID 58371139) has the molecular formula C27H20Br2 and a molecular weight of 504.27 g/mol. Its IUPAC name is 2,7-dibromo-9,9-bis(3-methylphenyl)fluorene.
| Compound Name | 2,7-dibromo-9,9-bis(3-methylphenyl)fluorene |
|---|---|
| PubChem CID | 58371139 |
| Molecular Formula | C27H20Br2 |
| Molecular Weight | 504.27 g/mol |
| Exact Mass | 501.99 |
| IUPAC Name | 2,7-dibromo-9,9-bis(3-methylphenyl)fluorene |
| SMILES | Cc1cccc(C2(c3cccc(C)c3)c3cc(Br)ccc3-c3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C27H20Br2/c1-17-5-3-7-19(13-17)27(20-8-4-6-18(2)14-20)25-15-21(28)9-11-23(25)24-12-10-22(29)16-26(24)27/h3-16H,1-2H3 |
| InChIKey | HPUKFZBLJUEPFU-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.27 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |