C21H16Br2 — CID 129015680
2,7-dibromo-9-methyl-9-(3-methylphenyl)fluorene (PubChem CID 129015680) has the molecular formula C21H16Br2 and a molecular weight of 428.17 g/mol. Its IUPAC name is 2,7-dibromo-9-methyl-9-(3-methylphenyl)fluorene.
| Compound Name | 2,7-dibromo-9-methyl-9-(3-methylphenyl)fluorene |
|---|---|
| PubChem CID | 129015680 |
| Molecular Formula | C21H16Br2 |
| Molecular Weight | 428.17 g/mol |
| Exact Mass | 425.96 |
| IUPAC Name | 2,7-dibromo-9-methyl-9-(3-methylphenyl)fluorene |
| SMILES | Cc1cccc(C2(C)c3cc(Br)ccc3-c3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C21H16Br2/c1-13-4-3-5-14(10-13)21(2)19-11-15(22)6-8-17(19)18-9-7-16(23)12-20(18)21/h3-12H,1-2H3 |
| InChIKey | QHRGUMZEZKUIBB-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.17 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |