C22H19Br — CID 166464478
4-bromo-2,7,9-trimethyl-9-phenylfluorene (PubChem CID 166464478) has the molecular formula C22H19Br and a molecular weight of 363.30 g/mol. Its IUPAC name is 4-bromo-2,7,9-trimethyl-9-phenylfluorene.
| Compound Name | 4-bromo-2,7,9-trimethyl-9-phenylfluorene |
|---|---|
| PubChem CID | 166464478 |
| Molecular Formula | C22H19Br |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 4-bromo-2,7,9-trimethyl-9-phenylfluorene |
| SMILES | Cc1ccc2c(c1)C(C)(c1ccccc1)c1cc(C)cc(Br)c1-2 |
| InChI | InChI=1S/C22H19Br/c1-14-9-10-17-18(11-14)22(3,16-7-5-4-6-8-16)19-12-15(2)13-20(23)21(17)19/h4-13H,1-3H3 |
| InChIKey | CGAVTTTVUFLKKD-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |