C37H28N2 — CID 154618871
4-(7,9-dimethyl-9-phenylfluoren-4-yl)-2,6-diphenylpyrimidine (PubChem CID 154618871) has the molecular formula C37H28N2 and a molecular weight of 500.65 g/mol. Its IUPAC name is 4-(7,9-dimethyl-9-phenylfluoren-4-yl)-2,6-diphenylpyrimidine.
| Compound Name | 4-(7,9-dimethyl-9-phenylfluoren-4-yl)-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 154618871 |
| Molecular Formula | C37H28N2 |
| Molecular Weight | 500.65 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | 4-(7,9-dimethyl-9-phenylfluoren-4-yl)-2,6-diphenylpyrimidine |
| SMILES | Cc1ccc2c(c1)C(C)(c1ccccc1)c1cccc(-c3cc(-c4ccccc4)nc(-c4ccccc4)n3)c1-2 |
| InChI | InChI=1S/C37H28N2/c1-25-21-22-29-32(23-25)37(2,28-17-10-5-11-18-28)31-20-12-19-30(35(29)31)34-24-33(26-13-6-3-7-14-26)38-36(39-34)27-15-8-4-9-16-27/h3-24H,1-2H3 |
| InChIKey | VAKJVQCFRDZJHW-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.65 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |