C35H25N3 — CID 125479874
2-[(9R)-9-methyl-9-phenylfluoren-4-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 125479874) has the molecular formula C35H25N3 and a molecular weight of 487.61 g/mol. Its IUPAC name is 2-[(9R)-9-methyl-9-phenylfluoren-4-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[(9R)-9-methyl-9-phenylfluoren-4-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 125479874 |
| Molecular Formula | C35H25N3 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | 2-[(9R)-9-methyl-9-phenylfluoren-4-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C[C@@]1(c2ccccc2)c2ccccc2-c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc21 |
| InChI | InChI=1S/C35H25N3/c1-35(26-18-9-4-10-19-26)29-22-12-11-20-27(29)31-28(21-13-23-30(31)35)34-37-32(24-14-5-2-6-15-24)36-33(38-34)25-16-7-3-8-17-25/h2-23H,1H3/t35-/m1/s1 |
| InChIKey | LVFAVSFHXZWQMK-PGUFJCEWSA-N |
| XLogP | 8.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |