C20H16O — CID 139484121
9-methyl-9-phenylfluoren-4-ol (PubChem CID 139484121) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is 9-methyl-9-phenylfluoren-4-ol.
| Compound Name | 9-methyl-9-phenylfluoren-4-ol |
|---|---|
| PubChem CID | 139484121 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 9-methyl-9-phenylfluoren-4-ol |
| SMILES | CC1(c2ccccc2)c2ccccc2-c2c(O)cccc21 |
| InChI | InChI=1S/C20H16O/c1-20(14-8-3-2-4-9-14)16-11-6-5-10-15(16)19-17(20)12-7-13-18(19)21/h2-13,21H,1H3 |
| InChIKey | DLQFGDQZLZIGCZ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |