C28H31Br — CID 166464533
4-bromo-2,7-ditert-butyl-9-methyl-9-phenylfluorene (PubChem CID 166464533) has the molecular formula C28H31Br and a molecular weight of 447.46 g/mol. Its IUPAC name is 4-bromo-2,7-ditert-butyl-9-methyl-9-phenylfluorene.
| Compound Name | 4-bromo-2,7-ditert-butyl-9-methyl-9-phenylfluorene |
|---|---|
| PubChem CID | 166464533 |
| Molecular Formula | C28H31Br |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 4-bromo-2,7-ditert-butyl-9-methyl-9-phenylfluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(c1ccccc1)c1cc(C(C)(C)C)cc(Br)c1-2 |
| InChI | InChI=1S/C28H31Br/c1-26(2,3)19-13-14-21-22(15-19)28(7,18-11-9-8-10-12-18)23-16-20(27(4,5)6)17-24(29)25(21)23/h8-17H,1-7H3 |
| InChIKey | YFGZTAWFVFNKDJ-UHFFFAOYSA-N |
| XLogP | 8.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |