C28H23Br3 — CID 134191319
1-[3,5-bis(2-bromophenyl)phenyl]-2-bromo-4-tert-butylbenzene (PubChem CID 134191319) has the molecular formula C28H23Br3 and a molecular weight of 599.20 g/mol. Its IUPAC name is 1-[3,5-bis(2-bromophenyl)phenyl]-2-bromo-4-tert-butylbenzene.
| Compound Name | 1-[3,5-bis(2-bromophenyl)phenyl]-2-bromo-4-tert-butylbenzene |
|---|---|
| PubChem CID | 134191319 |
| Molecular Formula | C28H23Br3 |
| Molecular Weight | 599.20 g/mol |
| Exact Mass | 595.93 |
| IUPAC Name | 1-[3,5-bis(2-bromophenyl)phenyl]-2-bromo-4-tert-butylbenzene |
| SMILES | CC(C)(C)c1ccc(-c2cc(-c3ccccc3Br)cc(-c3ccccc3Br)c2)c(Br)c1 |
| InChI | InChI=1S/C28H23Br3/c1-28(2,3)21-12-13-24(27(31)17-21)20-15-18(22-8-4-6-10-25(22)29)14-19(16-20)23-9-5-7-11-26(23)30/h4-17H,1-3H3 |
| InChIKey | KATCZFWYVQKBFD-UHFFFAOYSA-N |
| XLogP | 10.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.20 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |