About 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene
2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene (PubChem CID 58986922) has the molecular formula C41H42
and a molecular weight of 534.79 g/mol. Its IUPAC name is 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene.
Molecular Properties
| Compound Name | 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene |
| PubChem CID | 58986922 |
| Molecular Formula | C41H42 |
| Molecular Weight | 534.79 g/mol |
| Exact Mass | 534.33 |
| IUPAC Name | 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(-c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)c1-2 |
| InChI | InChI=1S/C41H42/c1-39(2,3)32-22-23-34-36(25-32)41(7,8)37-26-33(40(4,5)6)24-35(38(34)37)31-20-18-30(19-21-31)29-16-14-28(15-17-29)27-12-10-9-11-13-27/h9-26H,1-8H3 |
| InChIKey | QEBZHVHTWOTZKX-UHFFFAOYSA-N |
| XLogP | 11.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.79 |
| LogP ≤ 5 | 11.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene?
The IUPAC name of 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene (CID 58986922) is 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene.
What is the SMILES notation for 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene?
The canonical SMILES for 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene is CC(C)(C)c1ccc2c(c1)C(C)(C)c1cc(C(C)(C)C)cc(-c3ccc(-c4ccc(-c5ccccc5)cc4)cc3)c1-2.
What is the InChIKey of 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene?
The InChIKey is QEBZHVHTWOTZKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H42/c1-39(2,3)32-22-23-34-36(25-32)41(7,8)37-26-33(40(4,5)6)24-35(38(34)37)31-20-18-30(19-21-31)29-16-14-28(15-17-29)27-12-10-9-11-13-27/h9-26H,1-8H3.
What are the key properties of 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene?
2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene has a molecular weight of 534.79 g/mol, XLogP of 11.59, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-ditert-butyl-9,9-dimethyl-4-[4-(4-phenylphenyl)phenyl]fluorene is sourced from PubChem (CID 58986922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).