C52H55Ge — CID 59863416
CID 59863416 (PubChem CID 59863416) has the molecular formula C52H55Ge and a molecular weight of 752.62 g/mol.
| Compound Name | CID 59863416 |
|---|---|
| PubChem CID | 59863416 |
| Molecular Formula | C52H55Ge |
| Molecular Weight | 752.62 g/mol |
| Exact Mass | 753.35 |
| IUPAC Name | — |
| SMILES | CCC1(CC)c2cc(-c3cc(C(C)(C)C)cc4c3-c3ccc(C(C)(C)C)cc3C4(C)C)ccc2-c2ccc([Ge](c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C52H55Ge/c1-11-52(12-2)45-29-34(43-30-36(50(6,7)8)32-47-48(43)42-27-24-35(49(3,4)5)31-44(42)51(47,9)10)23-26-40(45)41-28-25-39(33-46(41)52)53(37-19-15-13-16-20-37)38-21-17-14-18-22-38/h13-33H,11-12H2,1-10H3 |
| InChIKey | MDISMQLEKYXTBG-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.62 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |