C41H35N — CID 144614370
3,4-bis(ethenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-7,9-dimethyl-N-naphthalen-1-yl-9-phenylfluoren-2-amine (PubChem CID 144614370) has the molecular formula C41H35N and a molecular weight of 541.74 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-7,9-dimethyl-N-naphthalen-1-yl-9-phenylfluoren-2-amine.
| Compound Name | 3,4-bis(ethenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-7,9-dimethyl-N-naphthalen-1-yl-9-phenylfluoren-2-amine |
|---|---|
| PubChem CID | 144614370 |
| Molecular Formula | C41H35N |
| Molecular Weight | 541.74 g/mol |
| Exact Mass | 541.28 |
| IUPAC Name | 3,4-bis(ethenyl)-N-[(3E)-hexa-1,3,5-trien-3-yl]-7,9-dimethyl-N-naphthalen-1-yl-9-phenylfluoren-2-amine |
| SMILES | C=C/C=C(\C=C)N(c1cc2c(c(C=C)c1C=C)-c1ccc(C)cc1C2(C)c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C41H35N/c1-7-17-31(8-2)42(38-23-16-19-29-18-14-15-22-34(29)38)39-27-37-40(33(10-4)32(39)9-3)35-25-24-28(5)26-36(35)41(37,6)30-20-12-11-13-21-30/h7-27H,1-4H2,5-6H3/b31-17+ |
| InChIKey | KXHKEYBBBHYHEG-KBVAKVRCSA-N |
| XLogP | 11.16 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.74 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|