C30H35N — CID 145144445
ethane;N-(4-methylphenyl)-N-[(3E)-penta-1,3-dien-3-yl]phenanthren-4-amine (PubChem CID 145144445) has the molecular formula C30H35N and a molecular weight of 409.62 g/mol. Its IUPAC name is ethane;N-(4-methylphenyl)-N-[(3E)-penta-1,3-dien-3-yl]phenanthren-4-amine.
| Compound Name | ethane;N-(4-methylphenyl)-N-[(3E)-penta-1,3-dien-3-yl]phenanthren-4-amine |
|---|---|
| PubChem CID | 145144445 |
| Molecular Formula | C30H35N |
| Molecular Weight | 409.62 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | ethane;N-(4-methylphenyl)-N-[(3E)-penta-1,3-dien-3-yl]phenanthren-4-amine |
| SMILES | C=C/C(=C\C)N(c1ccc(C)cc1)c1cccc2ccc3ccccc3c12.CC.CC |
| InChI | InChI=1S/C26H23N.2C2H6/c1-4-22(5-2)27(23-17-13-19(3)14-18-23)25-12-8-10-21-16-15-20-9-6-7-11-24(20)26(21)25;2*1-2/h4-18H,1H2,2-3H3;2*1-2H3/b22-5+;; |
| InChIKey | WMXRKIVCLRNHHP-MNGDNTMPSA-N |
| XLogP | 9.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.62 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|