C27H25N — CID 144756695
N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methyl-N-phenylphenanthren-9-amine (PubChem CID 144756695) has the molecular formula C27H25N and a molecular weight of 363.50 g/mol. Its IUPAC name is N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methyl-N-phenylphenanthren-9-amine.
| Compound Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methyl-N-phenylphenanthren-9-amine |
|---|---|
| PubChem CID | 144756695 |
| Molecular Formula | C27H25N |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methyl-N-phenylphenanthren-9-amine |
| SMILES | C/C=C\C(=C/C)N(c1ccccc1)c1cc2ccc(C)cc2c2ccccc12 |
| InChI | InChI=1S/C27H25N/c1-4-11-22(5-2)28(23-12-7-6-8-13-23)27-19-21-17-16-20(3)18-26(21)24-14-9-10-15-25(24)27/h4-19H,1-3H3/b11-4-,22-5+ |
| InChIKey | XGZGRIOGDHXNCQ-BCOOIZORSA-N |
| XLogP | 7.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|