C49H51N3 — CID 135251840
1-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[(2E,4E)-5-(N-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino)hexa-2,4-dien-2-yl]-3-N-(3-methylphenyl)-1-N,3-N-diphenylbenzene-1,3-diamine (PubChem CID 135251840) has the molecular formula C49H51N3 and a molecular weight of 681.97 g/mol. Its IUPAC name is 1-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[(2E,4E)-5-(N-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino)hexa-2,4-dien-2-yl]-3-N-(3-methylphenyl)-1-N,3-N-diphenylbenzene-1,3-diamine.
| Compound Name | 1-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[(2E,4E)-5-(N-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino)hexa-2,4-dien-2-yl]-3-N-(3-methylphenyl)-1-N,3-N-diphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 135251840 |
| Molecular Formula | C49H51N3 |
| Molecular Weight | 681.97 g/mol |
| Exact Mass | 681.41 |
| IUPAC Name | 1-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-4-[(2E,4E)-5-(N-[(2E,4Z)-hexa-2,4-dien-3-yl]anilino)hexa-2,4-dien-2-yl]-3-N-(3-methylphenyl)-1-N,3-N-diphenylbenzene-1,3-diamine |
| SMILES | C/C=C\C(=C/C)N(/C(C)=C/C=C(\C)c1ccc(N(C(/C=C\C)=C/C)c2ccccc2)cc1N(c1ccccc1)c1cccc(C)c1)c1ccccc1 |
| InChI | InChI=1S/C49H51N3/c1-8-22-41(10-3)50(43-25-15-12-16-26-43)40(7)33-32-39(6)48-35-34-47(51(42(11-4)23-9-2)44-27-17-13-18-28-44)37-49(48)52(45-29-19-14-20-30-45)46-31-21-24-38(5)36-46/h8-37H,1-7H3/b22-8-,23-9-,39-32+,40-33+,41-10+,42-11+ |
| InChIKey | MHQIBLVXEBKPBV-QBFQLHHKSA-N |
| XLogP | 14.38 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.97 |
| LogP ≤ 5 | 14.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|