C42H40N2 — CID 89241256
2-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-9,9-dimethyl-2-N,7-N-bis(3-methylphenyl)-7-N-phenylfluorene-2,7-diamine (PubChem CID 89241256) has the molecular formula C42H40N2 and a molecular weight of 572.80 g/mol. Its IUPAC name is 2-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-9,9-dimethyl-2-N,7-N-bis(3-methylphenyl)-7-N-phenylfluorene-2,7-diamine.
| Compound Name | 2-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-9,9-dimethyl-2-N,7-N-bis(3-methylphenyl)-7-N-phenylfluorene-2,7-diamine |
|---|---|
| PubChem CID | 89241256 |
| Molecular Formula | C42H40N2 |
| Molecular Weight | 572.80 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | 2-N-[(2E,4Z)-hepta-2,4,6-trien-3-yl]-9,9-dimethyl-2-N,7-N-bis(3-methylphenyl)-7-N-phenylfluorene-2,7-diamine |
| SMILES | C=C/C=C\C(=C/C)N(c1cccc(C)c1)c1ccc2c(c1)C(C)(C)c1cc(N(c3ccccc3)c3cccc(C)c3)ccc1-2 |
| InChI | InChI=1S/C42H40N2/c1-7-9-17-32(8-2)43(34-20-13-15-30(3)26-34)36-22-24-38-39-25-23-37(29-41(39)42(5,6)40(38)28-36)44(33-18-11-10-12-19-33)35-21-14-16-31(4)27-35/h7-29H,1H2,2-6H3/b17-9-,32-8+ |
| InChIKey | AMWKUBWWMWMLHW-QKWRAEHBSA-N |
| XLogP | 11.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.80 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|