C49H44N2 — CID 89049791
1,3,3,9,9-pentamethyl-N,N-diphenyl-2-[(1E)-2-(N-phenylanilino)buta-1,3-dienyl]cyclopenta[b]fluoren-7-amine (PubChem CID 89049791) has the molecular formula C49H44N2 and a molecular weight of 660.91 g/mol. Its IUPAC name is 1,3,3,9,9-pentamethyl-N,N-diphenyl-2-[(1E)-2-(N-phenylanilino)buta-1,3-dienyl]cyclopenta[b]fluoren-7-amine.
| Compound Name | 1,3,3,9,9-pentamethyl-N,N-diphenyl-2-[(1E)-2-(N-phenylanilino)buta-1,3-dienyl]cyclopenta[b]fluoren-7-amine |
|---|---|
| PubChem CID | 89049791 |
| Molecular Formula | C49H44N2 |
| Molecular Weight | 660.91 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | 1,3,3,9,9-pentamethyl-N,N-diphenyl-2-[(1E)-2-(N-phenylanilino)buta-1,3-dienyl]cyclopenta[b]fluoren-7-amine |
| SMILES | C=C/C(=C\C1=C(C)c2cc3c(cc2C1(C)C)-c1ccc(N(c2ccccc2)c2ccccc2)cc1C3(C)C)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C49H44N2/c1-7-35(50(36-20-12-8-13-21-36)37-22-14-9-15-23-37)30-44-34(2)42-32-47-43(33-46(42)48(44,3)4)41-29-28-40(31-45(41)49(47,5)6)51(38-24-16-10-17-25-38)39-26-18-11-19-27-39/h7-33H,1H2,2-6H3/b35-30+ |
| InChIKey | KAPIXXBSURPIFH-WUZYOQQESA-N |
| XLogP | 13.44 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.91 |
| LogP ≤ 5 | 13.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|