C34H37N3 — CID 144918425
3-methyl-N-[(2E,4Z)-1-[4-[methyl-[(3E)-6-methylhepta-1,3,5-trien-4-yl]amino]phenyl]iminohexa-2,4-dien-3-yl]-N-phenylaniline (PubChem CID 144918425) has the molecular formula C34H37N3 and a molecular weight of 487.69 g/mol. Its IUPAC name is 3-methyl-N-[(2E,4Z)-1-[4-[methyl-[(3E)-6-methylhepta-1,3,5-trien-4-yl]amino]phenyl]iminohexa-2,4-dien-3-yl]-N-phenylaniline.
| Compound Name | 3-methyl-N-[(2E,4Z)-1-[4-[methyl-[(3E)-6-methylhepta-1,3,5-trien-4-yl]amino]phenyl]iminohexa-2,4-dien-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 144918425 |
| Molecular Formula | C34H37N3 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 3-methyl-N-[(2E,4Z)-1-[4-[methyl-[(3E)-6-methylhepta-1,3,5-trien-4-yl]amino]phenyl]iminohexa-2,4-dien-3-yl]-N-phenylaniline |
| SMILES | C=C/C=C(\C=C(C)C)N(C)c1ccc(/N=C/C=C(\C=C/C)N(c2ccccc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C34H37N3/c1-7-13-31(37(32-16-10-9-11-17-32)34-18-12-15-28(5)26-34)23-24-35-29-19-21-30(22-20-29)36(6)33(14-8-2)25-27(3)4/h7-26H,2H2,1,3-6H3/b13-7-,31-23+,33-14+,35-24+ |
| InChIKey | IUICUASCCMPBRP-DSCRPVPWSA-N |
| XLogP | 9.47 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|