C42H56N2 — CID 145276184
ethane;1-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-pent-4-enyl-1-N,4-N-diphenylbenzene-1,4-diamine;2-methylpropane (PubChem CID 145276184) has the molecular formula C42H56N2 and a molecular weight of 588.92 g/mol. Its IUPAC name is ethane;1-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-pent-4-enyl-1-N,4-N-diphenylbenzene-1,4-diamine;2-methylpropane.
| Compound Name | ethane;1-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-pent-4-enyl-1-N,4-N-diphenylbenzene-1,4-diamine;2-methylpropane |
|---|---|
| PubChem CID | 145276184 |
| Molecular Formula | C42H56N2 |
| Molecular Weight | 588.92 g/mol |
| Exact Mass | 588.44 |
| IUPAC Name | ethane;1-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-2-pent-4-enyl-1-N,4-N-diphenylbenzene-1,4-diamine;2-methylpropane |
| SMILES | C=C/C=C(\C=C/C)N(c1ccccc1)c1ccc(N(C(/C=C\C)=C/C)c2ccccc2)cc1CCCC=C.CC.CC(C)C |
| InChI | InChI=1S/C36H40N2.C4H10.C2H6/c1-6-11-14-22-30-29-35(37(31(10-5)19-7-2)33-23-15-12-16-24-33)27-28-36(30)38(32(20-8-3)21-9-4)34-25-17-13-18-26-34;1-4(2)3;1-2/h6-10,12-13,15-21,23-29H,1,3,11,14,22H2,2,4-5H3;4H,1-3H3;1-2H3/b19-7-,21-9-,31-10+,32-20+;; |
| InChIKey | QRKPDKYLDOMTBL-WMJVTLGFSA-N |
| XLogP | 13.29 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.92 |
| LogP ≤ 5 | 13.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|