C41H46N2 — CID 143959467
4-ethyl-6-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-N-[(3E)-hexa-1,3-dien-3-yl]-6-N-(4-methylphenyl)-2-N-phenyl-8-propan-2-ylnaphthalene-2,6-diamine (PubChem CID 143959467) has the molecular formula C41H46N2 and a molecular weight of 566.83 g/mol. Its IUPAC name is 4-ethyl-6-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-N-[(3E)-hexa-1,3-dien-3-yl]-6-N-(4-methylphenyl)-2-N-phenyl-8-propan-2-ylnaphthalene-2,6-diamine.
| Compound Name | 4-ethyl-6-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-N-[(3E)-hexa-1,3-dien-3-yl]-6-N-(4-methylphenyl)-2-N-phenyl-8-propan-2-ylnaphthalene-2,6-diamine |
|---|---|
| PubChem CID | 143959467 |
| Molecular Formula | C41H46N2 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.37 |
| IUPAC Name | 4-ethyl-6-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2-N-[(3E)-hexa-1,3-dien-3-yl]-6-N-(4-methylphenyl)-2-N-phenyl-8-propan-2-ylnaphthalene-2,6-diamine |
| SMILES | C=C/C=C(\C=C/C)N(c1ccc(C)cc1)c1cc(C(C)C)c2cc(N(/C(C=C)=C/CC)c3ccccc3)cc(CC)c2c1 |
| InChI | InChI=1S/C41H46N2/c1-9-17-33(13-5)42(35-20-15-14-16-21-35)37-26-32(12-4)40-28-38(27-39(30(6)7)41(40)29-37)43(34(18-10-2)19-11-3)36-24-22-31(8)23-25-36/h10-11,13-30H,2,5,9,12H2,1,3-4,6-8H3/b19-11-,33-17+,34-18+ |
| InChIKey | MVWHJWAVODJETG-UBSCRAEGSA-N |
| XLogP | 12.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|