C46H44N2 — CID 155279550
N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]amino]phenyl]phenyl]-N-phenylaniline (PubChem CID 155279550) has the molecular formula C46H44N2 and a molecular weight of 624.87 g/mol. Its IUPAC name is N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]amino]phenyl]phenyl]-N-phenylaniline.
| Compound Name | N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]amino]phenyl]phenyl]-N-phenylaniline |
|---|---|
| PubChem CID | 155279550 |
| Molecular Formula | C46H44N2 |
| Molecular Weight | 624.87 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-4-[4-[4-[[(3E,5Z)-hepta-1,3,5-trien-3-yl]-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]amino]phenyl]phenyl]-N-phenylaniline |
| SMILES | C=C/C=C\C(=C/C=C)N(/C(C=C)=C/C=C\C)c1ccc(-c2ccc(-c3ccc(N(C(/C=C\C)=C/C=C)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H44N2/c1-7-13-21-41(12-6)47(43(20-11-5)22-14-8-2)45-33-29-39(30-34-45)37-25-27-38(28-26-37)40-31-35-46(36-32-40)48(42(18-9-3)19-10-4)44-23-16-15-17-24-44/h7-36H,2-3,5-6H2,1,4H3/b13-7-,19-10-,22-14-,41-21+,42-18+,43-20+ |
| InChIKey | ZXZXZWVVKBABSX-UQWLAMLKSA-N |
| XLogP | 13.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.87 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|