C39H44N2 — CID 167206123
(2E,4E,6E,8E)-5-ethenyl-2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methyl-2-N,9-N-diphenylundeca-2,4,6,8,10-pentaene-2,9-diamine (PubChem CID 167206123) has the molecular formula C39H44N2 and a molecular weight of 540.80 g/mol. Its IUPAC name is (2E,4E,6E,8E)-5-ethenyl-2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methyl-2-N,9-N-diphenylundeca-2,4,6,8,10-pentaene-2,9-diamine.
| Compound Name | (2E,4E,6E,8E)-5-ethenyl-2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methyl-2-N,9-N-diphenylundeca-2,4,6,8,10-pentaene-2,9-diamine |
|---|---|
| PubChem CID | 167206123 |
| Molecular Formula | C39H44N2 |
| Molecular Weight | 540.80 g/mol |
| Exact Mass | 540.35 |
| IUPAC Name | (2E,4E,6E,8E)-5-ethenyl-2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-9-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-6-methyl-2-N,9-N-diphenylundeca-2,4,6,8,10-pentaene-2,9-diamine |
| SMILES | C=C/C=C(\C=C/C)N(/C(C)=C/C=C(C=C)/C(C)=C/C=C(\C=C)N(C(/C=C\C)=C/C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C39H44N2/c1-9-21-35(13-5)41(39-26-19-16-20-27-39)36(14-6)31-28-32(7)34(12-4)30-29-33(8)40(37(22-10-2)23-11-3)38-24-17-15-18-25-38/h9-31H,2,4,6H2,1,3,5,7-8H3/b21-9-,23-11-,32-28+,33-29+,34-30+,35-13+,36-31+,37-22+ |
| InChIKey | JPONDPZRWZRVMO-ZDPQDBMCSA-N |
| XLogP | 11.16 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.80 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|