C29H31N — CID 144756694
ethane;N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methyl-N-phenylphenanthren-9-amine (PubChem CID 144756694) has the molecular formula C29H31N and a molecular weight of 393.57 g/mol. Its IUPAC name is ethane;N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methyl-N-phenylphenanthren-9-amine.
| Compound Name | ethane;N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methyl-N-phenylphenanthren-9-amine |
|---|---|
| PubChem CID | 144756694 |
| Molecular Formula | C29H31N |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | ethane;N-[(2E,4Z)-hexa-2,4-dien-3-yl]-3-methyl-N-phenylphenanthren-9-amine |
| SMILES | C/C=C\C(=C/C)N(c1ccccc1)c1cc2ccc(C)cc2c2ccccc12.CC |
| InChI | InChI=1S/C27H25N.C2H6/c1-4-11-22(5-2)28(23-12-7-6-8-13-23)27-19-21-17-16-20(3)18-26(21)24-14-9-10-15-25(24)27;1-2/h4-19H,1-3H3;1-2H3/b11-4-,22-5+; |
| InChIKey | GKDHMJMLWAFUMU-ITDMTSTASA-N |
| XLogP | 8.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|