C32H31N — CID 129146068
10-[(2E,4Z)-hexa-2,4-dien-2-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-phenylanthracen-9-amine (PubChem CID 129146068) has the molecular formula C32H31N and a molecular weight of 429.61 g/mol. Its IUPAC name is 10-[(2E,4Z)-hexa-2,4-dien-2-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-phenylanthracen-9-amine.
| Compound Name | 10-[(2E,4Z)-hexa-2,4-dien-2-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-phenylanthracen-9-amine |
|---|---|
| PubChem CID | 129146068 |
| Molecular Formula | C32H31N |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 10-[(2E,4Z)-hexa-2,4-dien-2-yl]-N-[(2E,4Z)-hexa-2,4-dien-3-yl]-N-phenylanthracen-9-amine |
| SMILES | C/C=C\C=C(/C)c1c2ccccc2c(N(C(/C=C\C)=C/C)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C32H31N/c1-5-8-17-24(4)31-27-20-12-14-22-29(27)32(30-23-15-13-21-28(30)31)33(25(7-3)16-6-2)26-18-10-9-11-19-26/h5-23H,1-4H3/b8-5-,16-6-,24-17+,25-7+ |
| InChIKey | BQFRPWBQRDMGGD-ONIPZIRBSA-N |
| XLogP | 9.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|