C17H15Br2N — CID 123816813
4-bromo-N-(4-bromophenyl)-N-penta-1,3-dien-3-ylaniline (PubChem CID 123816813) has the molecular formula C17H15Br2N and a molecular weight of 393.12 g/mol. Its IUPAC name is 4-bromo-N-(4-bromophenyl)-N-penta-1,3-dien-3-ylaniline.
| Compound Name | 4-bromo-N-(4-bromophenyl)-N-penta-1,3-dien-3-ylaniline |
|---|---|
| PubChem CID | 123816813 |
| Molecular Formula | C17H15Br2N |
| Molecular Weight | 393.12 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 4-bromo-N-(4-bromophenyl)-N-penta-1,3-dien-3-ylaniline |
| SMILES | C=CC(=CC)N(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C17H15Br2N/c1-3-15(4-2)20(16-9-5-13(18)6-10-16)17-11-7-14(19)8-12-17/h3-12H,1H2,2H3 |
| InChIKey | SZKJFOFTOTTWMT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.12 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|