C14H10Br2N2O2 — CID 154267801
N',N'-bis(4-bromophenyl)oxamide (PubChem CID 154267801) has the molecular formula C14H10Br2N2O2 and a molecular weight of 398.05 g/mol. Its IUPAC name is N',N'-bis(4-bromophenyl)oxamide.
| Compound Name | N',N'-bis(4-bromophenyl)oxamide |
|---|---|
| PubChem CID | 154267801 |
| Molecular Formula | C14H10Br2N2O2 |
| Molecular Weight | 398.05 g/mol |
| Exact Mass | 395.91 |
| IUPAC Name | N',N'-bis(4-bromophenyl)oxamide |
| SMILES | NC(=O)C(=O)N(c1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H10Br2N2O2/c15-9-1-5-11(6-2-9)18(14(20)13(17)19)12-7-3-10(16)4-8-12/h1-8H,(H2,17,19) |
| InChIKey | AXBZTVDPRSXWCQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.05 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|