About N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide
N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide (PubChem CID 71246778) has the molecular formula C18H17BrN2O2
and a molecular weight of 373.25 g/mol. Its IUPAC name is N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide.
Molecular Properties
| Compound Name | N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide |
| PubChem CID | 71246778 |
| Molecular Formula | C18H17BrN2O2 |
| Molecular Weight | 373.25 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide |
| SMILES | Cc1ccc(N(C(=O)C=CC(N)=O)c2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C18H17BrN2O2/c1-12-3-6-16(11-13(12)2)21(18(23)10-9-17(20)22)15-7-4-14(19)5-8-15/h3-11H,1-2H3,(H2,20,22) |
| InChIKey | KWOWEBPGYZPBTO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.25 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide?
The IUPAC name of N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide (CID 71246778) is N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide.
What is the SMILES notation for N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide?
The canonical SMILES for N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide is Cc1ccc(N(C(=O)C=CC(N)=O)c2ccc(Br)cc2)cc1C.
What is the InChIKey of N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide?
The InChIKey is KWOWEBPGYZPBTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17BrN2O2/c1-12-3-6-16(11-13(12)2)21(18(23)10-9-17(20)22)15-7-4-14(19)5-8-15/h3-11H,1-2H3,(H2,20,22).
What are the key properties of N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide?
N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide has a molecular weight of 373.25 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-bromophenyl)-N'-(3,4-dimethylphenyl)but-2-enediamide is sourced from PubChem (CID 71246778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).