C17H18N2O4 — CID 87884333
(3,4-dimethylphenyl)-[4-[2-(hydroxyamino)-2-oxoethyl]phenyl]carbamic acid (PubChem CID 87884333) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-[4-[2-(hydroxyamino)-2-oxoethyl]phenyl]carbamic acid.
| Compound Name | (3,4-dimethylphenyl)-[4-[2-(hydroxyamino)-2-oxoethyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 87884333 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (3,4-dimethylphenyl)-[4-[2-(hydroxyamino)-2-oxoethyl]phenyl]carbamic acid |
| SMILES | Cc1ccc(N(C(=O)O)c2ccc(CC(=O)NO)cc2)cc1C |
| InChI | InChI=1S/C17H18N2O4/c1-11-3-6-15(9-12(11)2)19(17(21)22)14-7-4-13(5-8-14)10-16(20)18-23/h3-9,23H,10H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | PAHXUOVNUDKKEF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|