C17H17BrO3 — CID 889898
(4-bromophenyl) (2S)-2-(3,4-dimethylphenoxy)propanoate (PubChem CID 889898) has the molecular formula C17H17BrO3 and a molecular weight of 349.22 g/mol. Its IUPAC name is (4-bromophenyl) (2S)-2-(3,4-dimethylphenoxy)propanoate.
| Compound Name | (4-bromophenyl) (2S)-2-(3,4-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 889898 |
| Molecular Formula | C17H17BrO3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | (4-bromophenyl) (2S)-2-(3,4-dimethylphenoxy)propanoate |
| SMILES | Cc1ccc(O[C@@H](C)C(=O)Oc2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C17H17BrO3/c1-11-4-7-16(10-12(11)2)20-13(3)17(19)21-15-8-5-14(18)6-9-15/h4-10,13H,1-3H3/t13-/m0/s1 |
| InChIKey | AFTPWCAERXNCTN-ZDUSSCGKSA-N |
| XLogP | 4.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|