(2R)-2-(3,4-dimethylphenoxy)propanoyl chloride

C11H13ClO2 — CID 51663756

IUPAC(2R)-2-(3,4-dimethylphenoxy)propanoyl chloride
SMILESCc1ccc(O[C@H](C)C(=O)Cl)cc1C
InChIInChI=1S/C11H13ClO2/c1-7-4-5-10(6-8(7)2)14-9(3)11(12)13/h4-6,9H,1-3H3/t9-/m1/s1
InChIKeyLUUGKJSEGMOEKP-SECBINFHSA-N
MW212.68 g/mol
LogP2.84
Rot. Bonds3

About (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride

(2R)-2-(3,4-dimethylphenoxy)propanoyl chloride (PubChem CID 51663756) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride.

Molecular Properties

Compound Name(2R)-2-(3,4-dimethylphenoxy)propanoyl chloride
PubChem CID51663756
Molecular FormulaC11H13ClO2
Molecular Weight212.68 g/mol
Exact Mass212.06
IUPAC Name(2R)-2-(3,4-dimethylphenoxy)propanoyl chloride
SMILESCc1ccc(O[C@H](C)C(=O)Cl)cc1C
InChIInChI=1S/C11H13ClO2/c1-7-4-5-10(6-8(7)2)14-9(3)11(12)13/h4-6,9H,1-3H3/t9-/m1/s1
InChIKeyLUUGKJSEGMOEKP-SECBINFHSA-N
XLogP2.84
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.68
LogP ≤ 52.84
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride?
The IUPAC name of (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride (CID 51663756) is (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride.
What is the SMILES notation for (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride?
The canonical SMILES for (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride is Cc1ccc(O[C@H](C)C(=O)Cl)cc1C.
What is the InChIKey of (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride?
The InChIKey is LUUGKJSEGMOEKP-SECBINFHSA-N. The full InChI is InChI=1S/C11H13ClO2/c1-7-4-5-10(6-8(7)2)14-9(3)11(12)13/h4-6,9H,1-3H3/t9-/m1/s1.
What are the key properties of (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride?
(2R)-2-(3,4-dimethylphenoxy)propanoyl chloride has a molecular weight of 212.68 g/mol, XLogP of 2.84, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(3,4-dimethylphenoxy)propanoyl chloride is sourced from PubChem (CID 51663756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).