C11H13O3- — CID 4744716
2-(3,4-dimethylphenoxy)propanoate (PubChem CID 4744716) has the molecular formula C11H13O3- and a molecular weight of 193.22 g/mol. Its IUPAC name is 2-(3,4-dimethylphenoxy)propanoate.
| Compound Name | 2-(3,4-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 4744716 |
| Molecular Formula | C11H13O3- |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 2-(3,4-dimethylphenoxy)propanoate |
| SMILES | Cc1ccc(OC(C)C(=O)[O-])cc1C |
| InChI | InChI=1S/C11H14O3/c1-7-4-5-10(6-8(7)2)14-9(3)11(12)13/h4-6,9H,1-3H3,(H,12,13)/p-1 |
| InChIKey | UIOGKMYERRPYJZ-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |