C17H17FO3 — CID 891244
(4-fluorophenyl) (2S)-2-(3,4-dimethylphenoxy)propanoate (PubChem CID 891244) has the molecular formula C17H17FO3 and a molecular weight of 288.32 g/mol. Its IUPAC name is (4-fluorophenyl) (2S)-2-(3,4-dimethylphenoxy)propanoate.
| Compound Name | (4-fluorophenyl) (2S)-2-(3,4-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 891244 |
| Molecular Formula | C17H17FO3 |
| Molecular Weight | 288.32 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (4-fluorophenyl) (2S)-2-(3,4-dimethylphenoxy)propanoate |
| SMILES | Cc1ccc(O[C@@H](C)C(=O)Oc2ccc(F)cc2)cc1C |
| InChI | InChI=1S/C17H17FO3/c1-11-4-7-16(10-12(11)2)20-13(3)17(19)21-15-8-5-14(18)6-9-15/h4-10,13H,1-3H3/t13-/m0/s1 |
| InChIKey | IIVTYSVOKVRFDV-ZDUSSCGKSA-N |
| XLogP | 3.82 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.32 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|