C17H19N — CID 142973310
N-cyclohexa-1,5-dien-1-yl-N-[(3E)-penta-1,3-dien-3-yl]aniline (PubChem CID 142973310) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-[(3E)-penta-1,3-dien-3-yl]aniline.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-[(3E)-penta-1,3-dien-3-yl]aniline |
|---|---|
| PubChem CID | 142973310 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-[(3E)-penta-1,3-dien-3-yl]aniline |
| SMILES | C=C/C(=C\C)N(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C17H19N/c1-3-15(4-2)18(16-11-7-5-8-12-16)17-13-9-6-10-14-17/h3-5,7-9,11-14H,1,6,10H2,2H3/b15-4+ |
| InChIKey | KIWGTFRDKVMFDC-SYZQJQIISA-N |
| XLogP | 4.82 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|