C54H44N2 — CID 145117481
N-cyclohexa-1,5-dien-1-yl-3-[2-[3-(N-[(3E)-hexa-1,3,5-trien-3-yl]-4-phenylanilino)phenyl]phenyl]-N-(4-phenylphenyl)aniline (PubChem CID 145117481) has the molecular formula C54H44N2 and a molecular weight of 720.96 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-3-[2-[3-(N-[(3E)-hexa-1,3,5-trien-3-yl]-4-phenylanilino)phenyl]phenyl]-N-(4-phenylphenyl)aniline.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-3-[2-[3-(N-[(3E)-hexa-1,3,5-trien-3-yl]-4-phenylanilino)phenyl]phenyl]-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 145117481 |
| Molecular Formula | C54H44N2 |
| Molecular Weight | 720.96 g/mol |
| Exact Mass | 720.35 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-3-[2-[3-(N-[(3E)-hexa-1,3,5-trien-3-yl]-4-phenylanilino)phenyl]phenyl]-N-(4-phenylphenyl)aniline |
| SMILES | C=C/C=C(\C=C)N(c1ccc(-c2ccccc2)cc1)c1cccc(-c2ccccc2-c2cccc(N(C3=CCCC=C3)c3ccc(-c4ccccc4)cc3)c2)c1 |
| InChI | InChI=1S/C54H44N2/c1-3-18-47(4-2)55(49-35-31-43(32-36-49)41-19-8-5-9-20-41)51-27-16-23-45(39-51)53-29-14-15-30-54(53)46-24-17-28-52(40-46)56(48-25-12-7-13-26-48)50-37-33-44(34-38-50)42-21-10-6-11-22-42/h3-6,8-12,14-40H,1-2,7,13H2/b47-18+ |
| InChIKey | WJRPMDYCDHJABC-ZWORHOEWSA-N |
| XLogP | 15.12 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.96 |
| LogP ≤ 5 | 15.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|