About N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline
N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline (PubChem CID 163940531) has the molecular formula C17H21N
and a molecular weight of 239.36 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline |
| PubChem CID | 163940531 |
| Molecular Formula | C17H21N |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline |
| SMILES | C=CCCCN(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C17H21N/c1-2-3-10-15-18(16-11-6-4-7-12-16)17-13-8-5-9-14-17/h2,4,6-8,11-14H,1,3,5,9-10,15H2 |
| InChIKey | RQPHCYGOSOZVSC-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline (CID 163940531) is N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline is C=CCCCN(C1=CCCC=C1)c1ccccc1.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline?
The InChIKey is RQPHCYGOSOZVSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N/c1-2-3-10-15-18(16-11-6-4-7-12-16)17-13-8-5-9-14-17/h2,4,6-8,11-14H,1,3,5,9-10,15H2.
What are the key properties of N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline?
N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline has a molecular weight of 239.36 g/mol, XLogP of 4.69, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-N-pent-4-enylaniline is sourced from PubChem (CID 163940531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).