C13H14N2 — CID 146563747
N-cyclohexa-1,5-dien-1-yl-N-(methylideneamino)aniline (PubChem CID 146563747) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-N-(methylideneamino)aniline.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-N-(methylideneamino)aniline |
|---|---|
| PubChem CID | 146563747 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-N-(methylideneamino)aniline |
| SMILES | C=NN(C1=CCCC=C1)c1ccccc1 |
| InChI | InChI=1S/C13H14N2/c1-14-15(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2,4-6,8-11H,1,3,7H2 |
| InChIKey | MLKJHYBPXPZYKN-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|