C27H45N — CID 143893831
butane;N-cyclohexa-1,5-dien-1-yl-N-[(3E)-hepta-1,3-dien-3-yl]aniline;ethane (PubChem CID 143893831) has the molecular formula C27H45N and a molecular weight of 383.66 g/mol. Its IUPAC name is butane;N-cyclohexa-1,5-dien-1-yl-N-[(3E)-hepta-1,3-dien-3-yl]aniline;ethane.
| Compound Name | butane;N-cyclohexa-1,5-dien-1-yl-N-[(3E)-hepta-1,3-dien-3-yl]aniline;ethane |
|---|---|
| PubChem CID | 143893831 |
| Molecular Formula | C27H45N |
| Molecular Weight | 383.66 g/mol |
| Exact Mass | 383.36 |
| IUPAC Name | butane;N-cyclohexa-1,5-dien-1-yl-N-[(3E)-hepta-1,3-dien-3-yl]aniline;ethane |
| SMILES | C=C/C(=C\CCC)N(C1=CCCC=C1)c1ccccc1.CC.CC.CCCC |
| InChI | InChI=1S/C19H23N.C4H10.2C2H6/c1-3-5-12-17(4-2)20(18-13-8-6-9-14-18)19-15-10-7-11-16-19;1-3-4-2;2*1-2/h4,6,8-10,12-16H,2-3,5,7,11H2,1H3;3-4H2,1-2H3;2*1-2H3/b17-12+;;; |
| InChIKey | ZDWIHALRESQEDL-DPSBJRLESA-N |
| XLogP | 9.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.66 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|