C38H37N — CID 123697271
1-but-2-en-2-yl-2,3-dimethyl-N-penta-1,3-dien-3-yl-1-phenyl-N-(4-phenylphenyl)inden-4-amine (PubChem CID 123697271) has the molecular formula C38H37N and a molecular weight of 507.72 g/mol. Its IUPAC name is 1-but-2-en-2-yl-2,3-dimethyl-N-penta-1,3-dien-3-yl-1-phenyl-N-(4-phenylphenyl)inden-4-amine.
| Compound Name | 1-but-2-en-2-yl-2,3-dimethyl-N-penta-1,3-dien-3-yl-1-phenyl-N-(4-phenylphenyl)inden-4-amine |
|---|---|
| PubChem CID | 123697271 |
| Molecular Formula | C38H37N |
| Molecular Weight | 507.72 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 1-but-2-en-2-yl-2,3-dimethyl-N-penta-1,3-dien-3-yl-1-phenyl-N-(4-phenylphenyl)inden-4-amine |
| SMILES | C=CC(=CC)N(c1ccc(-c2ccccc2)cc1)c1cccc2c1C(C)=C(C)C2(C(C)=CC)c1ccccc1 |
| InChI | InChI=1S/C38H37N/c1-7-27(4)38(32-19-14-11-15-20-32)29(6)28(5)37-35(38)21-16-22-36(37)39(33(8-2)9-3)34-25-23-31(24-26-34)30-17-12-10-13-18-30/h7-26H,2H2,1,3-6H3 |
| InChIKey | PJPYJZGWWUMTLT-UHFFFAOYSA-N |
| XLogP | 10.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.72 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|