C49H46N2 — CID 123690514
4-N-[4-(1-but-2-en-2-yl-3-ethenyl-2-methylinden-1-yl)phenyl]-1-N,1-N,4-N-tris(4-methylphenyl)benzene-1,4-diamine (PubChem CID 123690514) has the molecular formula C49H46N2 and a molecular weight of 662.92 g/mol. Its IUPAC name is 4-N-[4-(1-but-2-en-2-yl-3-ethenyl-2-methylinden-1-yl)phenyl]-1-N,1-N,4-N-tris(4-methylphenyl)benzene-1,4-diamine.
| Compound Name | 4-N-[4-(1-but-2-en-2-yl-3-ethenyl-2-methylinden-1-yl)phenyl]-1-N,1-N,4-N-tris(4-methylphenyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 123690514 |
| Molecular Formula | C49H46N2 |
| Molecular Weight | 662.92 g/mol |
| Exact Mass | 662.37 |
| IUPAC Name | 4-N-[4-(1-but-2-en-2-yl-3-ethenyl-2-methylinden-1-yl)phenyl]-1-N,1-N,4-N-tris(4-methylphenyl)benzene-1,4-diamine |
| SMILES | C=CC1=C(C)C(C(C)=CC)(c2ccc(N(c3ccc(C)cc3)c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C49H46N2/c1-8-37(6)49(38(7)46(9-2)47-12-10-11-13-48(47)49)39-20-28-43(29-21-39)51(42-26-18-36(5)19-27-42)45-32-30-44(31-33-45)50(40-22-14-34(3)15-23-40)41-24-16-35(4)17-25-41/h8-33H,2H2,1,3-7H3 |
| InChIKey | ISDGGPUEWMYBFI-UHFFFAOYSA-N |
| XLogP | 13.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.92 |
| LogP ≤ 5 | 13.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|