C34H33N — CID 143811419
4-[9-[(E)-but-2-en-2-yl]-9-(4-methylphenyl)fluoren-2-yl]-2-methyl-N-prop-2-enylaniline (PubChem CID 143811419) has the molecular formula C34H33N and a molecular weight of 455.65 g/mol. Its IUPAC name is 4-[9-[(E)-but-2-en-2-yl]-9-(4-methylphenyl)fluoren-2-yl]-2-methyl-N-prop-2-enylaniline.
| Compound Name | 4-[9-[(E)-but-2-en-2-yl]-9-(4-methylphenyl)fluoren-2-yl]-2-methyl-N-prop-2-enylaniline |
|---|---|
| PubChem CID | 143811419 |
| Molecular Formula | C34H33N |
| Molecular Weight | 455.65 g/mol |
| Exact Mass | 455.26 |
| IUPAC Name | 4-[9-[(E)-but-2-en-2-yl]-9-(4-methylphenyl)fluoren-2-yl]-2-methyl-N-prop-2-enylaniline |
| SMILES | C=CCNc1ccc(-c2ccc3c(c2)C(/C(C)=C/C)(c2ccc(C)cc2)c2ccccc2-3)cc1C |
| InChI | InChI=1S/C34H33N/c1-6-20-35-33-19-15-26(21-24(33)4)27-14-18-30-29-10-8-9-11-31(29)34(25(5)7-2,32(30)22-27)28-16-12-23(3)13-17-28/h6-19,21-22,35H,1,20H2,2-5H3/b25-7+ |
| InChIKey | RSUXPYGZMROZAJ-JRXWSOMVSA-N |
| XLogP | 8.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.65 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|