C22H19I — CID 70971884
2-(4-iodo-3-methylphenyl)-9,9-dimethylfluorene (PubChem CID 70971884) has the molecular formula C22H19I and a molecular weight of 410.30 g/mol. Its IUPAC name is 2-(4-iodo-3-methylphenyl)-9,9-dimethylfluorene.
| Compound Name | 2-(4-iodo-3-methylphenyl)-9,9-dimethylfluorene |
|---|---|
| PubChem CID | 70971884 |
| Molecular Formula | C22H19I |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-(4-iodo-3-methylphenyl)-9,9-dimethylfluorene |
| SMILES | Cc1cc(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)ccc1I |
| InChI | InChI=1S/C22H19I/c1-14-12-15(9-11-21(14)23)16-8-10-18-17-6-4-5-7-19(17)22(2,3)20(18)13-16/h4-13H,1-3H3 |
| InChIKey | HKBWPJAQBGYLPX-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|