C24H24 — CID 176635457
9,9-dimethyl-2-(2,4,6-trimethylphenyl)fluorene (PubChem CID 176635457) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is 9,9-dimethyl-2-(2,4,6-trimethylphenyl)fluorene.
| Compound Name | 9,9-dimethyl-2-(2,4,6-trimethylphenyl)fluorene |
|---|---|
| PubChem CID | 176635457 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 9,9-dimethyl-2-(2,4,6-trimethylphenyl)fluorene |
| SMILES | Cc1cc(C)c(-c2ccc3c(c2)C(C)(C)c2ccccc2-3)c(C)c1 |
| InChI | InChI=1S/C24H24/c1-15-12-16(2)23(17(3)13-15)18-10-11-20-19-8-6-7-9-21(19)24(4,5)22(20)14-18/h6-14H,1-5H3 |
| InChIKey | FOIDDNQQOBILND-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |