C50H39NO — CID 137397204
9,9-diphenyl-7-(4-phenyl-N-[(3E,5Z)-5-phenylhepta-1,3,5-trien-4-yl]anilino)fluoren-4-ol (PubChem CID 137397204) has the molecular formula C50H39NO and a molecular weight of 669.87 g/mol. Its IUPAC name is 9,9-diphenyl-7-(4-phenyl-N-[(3E,5Z)-5-phenylhepta-1,3,5-trien-4-yl]anilino)fluoren-4-ol.
| Compound Name | 9,9-diphenyl-7-(4-phenyl-N-[(3E,5Z)-5-phenylhepta-1,3,5-trien-4-yl]anilino)fluoren-4-ol |
|---|---|
| PubChem CID | 137397204 |
| Molecular Formula | C50H39NO |
| Molecular Weight | 669.87 g/mol |
| Exact Mass | 669.30 |
| IUPAC Name | 9,9-diphenyl-7-(4-phenyl-N-[(3E,5Z)-5-phenylhepta-1,3,5-trien-4-yl]anilino)fluoren-4-ol |
| SMILES | C=C/C=C(C(=C/C)\c1ccccc1)/N(c1ccc(-c2ccccc2)cc1)c1ccc2c(c1)C(c1ccccc1)(c1ccccc1)c1cccc(O)c1-2 |
| InChI | InChI=1S/C50H39NO/c1-3-18-47(43(4-2)38-21-11-6-12-22-38)51(41-31-29-37(30-32-41)36-19-9-5-10-20-36)42-33-34-44-46(35-42)50(39-23-13-7-14-24-39,40-25-15-8-16-26-40)45-27-17-28-48(52)49(44)45/h3-35,52H,1H2,2H3/b43-4-,47-18+ |
| InChIKey | WSDSSYZXETXHTN-LANJBNLTSA-N |
| XLogP | 12.73 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.87 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|