C37H27Cl — CID 142604931
2-chloro-9-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-5,9-diphenylfluorene (PubChem CID 142604931) has the molecular formula C37H27Cl and a molecular weight of 507.08 g/mol. Its IUPAC name is 2-chloro-9-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-5,9-diphenylfluorene.
| Compound Name | 2-chloro-9-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-5,9-diphenylfluorene |
|---|---|
| PubChem CID | 142604931 |
| Molecular Formula | C37H27Cl |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 2-chloro-9-[4-[(3E)-hexa-1,3,5-trien-3-yl]phenyl]-5,9-diphenylfluorene |
| SMILES | C=C/C=C(\C=C)c1ccc(C2(c3ccccc3)c3cc(Cl)ccc3-c3c(-c4ccccc4)cccc32)cc1 |
| InChI | InChI=1S/C37H27Cl/c1-3-12-26(4-2)27-19-21-30(22-20-27)37(29-15-9-6-10-16-29)34-18-11-17-32(28-13-7-5-8-14-28)36(34)33-24-23-31(38)25-35(33)37/h3-25H,1-2H2/b26-12+ |
| InChIKey | NLWRAMYDHAGARI-RPPGKUMJSA-N |
| XLogP | 10.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|