C49H37N5O — CID 167485527
5-[4-[4-(9,9-diphenylfluoren-4-yl)-6-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,5-triazin-2-yl]phenyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 167485527) has the molecular formula C49H37N5O and a molecular weight of 711.87 g/mol. Its IUPAC name is 5-[4-[4-(9,9-diphenylfluoren-4-yl)-6-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,5-triazin-2-yl]phenyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[4-[4-(9,9-diphenylfluoren-4-yl)-6-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,5-triazin-2-yl]phenyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 167485527 |
| Molecular Formula | C49H37N5O |
| Molecular Weight | 711.87 g/mol |
| Exact Mass | 711.30 |
| IUPAC Name | 5-[4-[4-(9,9-diphenylfluoren-4-yl)-6-[(3E)-hexa-1,3,5-trien-3-yl]-1,3,5-triazin-2-yl]phenyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | C=C/C=C(\C=C)c1nc(-c2ccc(-c3ccc4c(c3)n(C)c(=O)n4C)cc2)nc(-c2cccc3c2-c2ccccc2C3(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C49H37N5O/c1-5-16-32(6-2)45-50-46(34-27-25-33(26-28-34)35-29-30-42-43(31-35)54(4)48(55)53(42)3)52-47(51-45)39-22-15-24-41-44(39)38-21-13-14-23-40(38)49(41,36-17-9-7-10-18-36)37-19-11-8-12-20-37/h5-31H,1-2H2,3-4H3/b32-16+ |
| InChIKey | IOSRCAXCRHBESX-KPGMTVGESA-N |
| XLogP | 10.18 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.87 |
| LogP ≤ 5 | 10.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|