C49H35N5O — CID 172507661
5-[4-[4-(9,9-diphenylfluoren-4-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 172507661) has the molecular formula C49H35N5O and a molecular weight of 714.88 g/mol. Its IUPAC name is 5-[4-[4-(9,9-diphenylfluoren-4-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-[4-[4-(9,9-diphenylfluoren-4-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 172507661 |
| Molecular Formula | C49H35N5O |
| Molecular Weight | 714.88 g/mol |
| Exact Mass | 714.32 |
| IUPAC Name | 5-[4-[4-(9,9-diphenylfluoren-4-yl)-6-(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazin-2-yl]phenyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | [2H]c1c([2H])c([2H])c(-c2nc(-c3ccc(-c4ccc5c(c4)n(C)c(=O)n5C)cc3)nc(-c3cccc4c3-c3ccccc3C4(c3ccccc3)c3ccccc3)n2)c([2H])c1[2H] |
| InChI | InChI=1S/C49H35N5O/c1-53-42-30-29-35(31-43(42)54(2)48(53)55)32-25-27-34(28-26-32)46-50-45(33-15-6-3-7-16-33)51-47(52-46)39-22-14-24-41-44(39)38-21-12-13-23-40(38)49(41,36-17-8-4-9-18-36)37-19-10-5-11-20-37/h3-31H,1-2H3/i3D,6D,7D,15D,16D |
| InChIKey | IWUBVWWRWVSYGM-QRCSGGRDSA-N |
| XLogP | 10.09 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.88 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |