C58H37N3S — CID 166024950
2-(4-dibenzothiophen-2-ylphenyl)-4-(9,9-diphenylfluoren-4-yl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine (PubChem CID 166024950) has the molecular formula C58H37N3S and a molecular weight of 817.08 g/mol. Its IUPAC name is 2-(4-dibenzothiophen-2-ylphenyl)-4-(9,9-diphenylfluoren-4-yl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(4-dibenzothiophen-2-ylphenyl)-4-(9,9-diphenylfluoren-4-yl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 166024950 |
| Molecular Formula | C58H37N3S |
| Molecular Weight | 817.08 g/mol |
| Exact Mass | 816.33 |
| IUPAC Name | 2-(4-dibenzothiophen-2-ylphenyl)-4-(9,9-diphenylfluoren-4-yl)-6-[2,3,5,6-tetradeuterio-4-(2,3,4,5,6-pentadeuteriophenyl)phenyl]-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c(-c3nc(-c4ccc(-c5ccc6sc7ccccc7c6c5)cc4)nc(-c4cccc5c4-c4ccccc4C5(c4ccccc4)c4ccccc4)n3)c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C58H37N3S/c1-4-15-38(16-5-1)39-27-31-41(32-28-39)55-59-56(42-33-29-40(30-34-42)43-35-36-53-49(37-43)46-21-11-13-26-52(46)62-53)61-57(60-55)48-23-14-25-51-54(48)47-22-10-12-24-50(47)58(51,44-17-6-2-7-18-44)45-19-8-3-9-20-45/h1-37H/i1D,4D,5D,15D,16D,27D,28D,31D,32D |
| InChIKey | WXHXSQLMUAEHRH-MUVXGNGJSA-N |
| XLogP | 14.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.08 |
| LogP ≤ 5 | 14.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |